C12H15ClN2O3S — CID 168673732
[5-oxo-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673732) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is [5-oxo-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673732 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | [5-oxo-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1CCc1ccccn1 |
| InChI | InChI=1S/C12H15ClN2O3S/c13-19(17,18)9-10-7-12(16)15(8-10)6-4-11-3-1-2-5-14-11/h1-3,5,10H,4,6-9H2 |
| InChIKey | DZXIFHYBECLVLU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |