C13H15Cl2NO3S — CID 168673680
[1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673680) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is [1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673680 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [1-[2-(4-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15Cl2NO3S/c14-12-3-1-10(2-4-12)5-6-16-8-11(7-13(16)17)9-20(15,18)19/h1-4,11H,5-9H2 |
| InChIKey | SWHDASHPLPATRT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |