C15H16ClN3O3S — CID 168673730
[5-oxo-1-(2-quinoxalin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673730) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is [5-oxo-1-(2-quinoxalin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-(2-quinoxalin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673730 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [5-oxo-1-(2-quinoxalin-2-ylethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1CCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H16ClN3O3S/c16-23(21,22)10-11-7-15(20)19(9-11)6-5-12-8-17-13-3-1-2-4-14(13)18-12/h1-4,8,11H,5-7,9-10H2 |
| InChIKey | LIQAPCSQNATXPR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |