C10H12ClN3O3S — CID 168673835
[5-oxo-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673835) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is [5-oxo-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673835 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [5-oxo-1-(pyrimidin-5-ylmethyl)pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1Cc1cncnc1 |
| InChI | InChI=1S/C10H12ClN3O3S/c11-18(16,17)6-8-1-10(15)14(4-8)5-9-2-12-7-13-3-9/h2-3,7-8H,1,4-6H2 |
| InChIKey | IIDLZFHXMPOYGF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |