C15H20ClNO4S — CID 168672695
[5-oxo-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672695) has the molecular formula C15H20ClNO4S and a molecular weight of 345.85 g/mol. Its IUPAC name is [5-oxo-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672695 |
| Molecular Formula | C15H20ClNO4S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [5-oxo-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CC(C)Oc1ccc(CN2CC(CS(=O)(=O)Cl)CC2=O)cc1 |
| InChI | InChI=1S/C15H20ClNO4S/c1-11(2)21-14-5-3-12(4-6-14)8-17-9-13(7-15(17)18)10-22(16,19)20/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | CVUMLXGLAHXNLN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |