C13H16FNO5S2 — CID 168675804
[1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675804) has the molecular formula C13H16FNO5S2 and a molecular weight of 349.41 g/mol. Its IUPAC name is [1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675804 |
| Molecular Formula | C13H16FNO5S2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | [1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CS(=O)(=O)c1ccc(CN2CC(CS(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C13H16FNO5S2/c1-21(17,18)12-4-2-10(3-5-12)7-15-8-11(6-13(15)16)9-22(14,19)20/h2-5,11H,6-9H2,1H3 |
| InChIKey | BQBCJUGKWJHUST-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |