C15H19NO4S2 — CID 168666966
S-[[1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666966) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is S-[[1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666966 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | S-[[1-[(4-methylsulfonylphenyl)methyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(Cc2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C15H19NO4S2/c1-11(17)21-10-13-7-15(18)16(9-13)8-12-3-5-14(6-4-12)22(2,19)20/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | SOLCVWADOGPLQH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|