C16H22ClNO4S — CID 168672681
[1-[[4-(2-methylpropoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672681) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is [1-[[4-(2-methylpropoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[[4-(2-methylpropoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672681 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [1-[[4-(2-methylpropoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CC(C)COc1ccc(CN2CC(CS(=O)(=O)Cl)CC2=O)cc1 |
| InChI | InChI=1S/C16H22ClNO4S/c1-12(2)10-22-15-5-3-13(4-6-15)8-18-9-14(7-16(18)19)11-23(17,20)21/h3-6,12,14H,7-11H2,1-2H3 |
| InChIKey | NXABOCGUTDIVJU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |