C18H21N3O3S2 — CID 89239101
N-[5-(1,3-benzothiazol-6-ylsulfonyl)-5-azaspiro[3.5]nonan-8-yl]prop-2-enamide (PubChem CID 89239101) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-6-ylsulfonyl)-5-azaspiro[3.5]nonan-8-yl]prop-2-enamide.
| Compound Name | N-[5-(1,3-benzothiazol-6-ylsulfonyl)-5-azaspiro[3.5]nonan-8-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89239101 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[5-(1,3-benzothiazol-6-ylsulfonyl)-5-azaspiro[3.5]nonan-8-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc3ncsc3c2)C2(CCC2)C1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-2-17(22)20-13-6-9-21(18(11-13)7-3-8-18)26(23,24)14-4-5-15-16(10-14)25-12-19-15/h2,4-5,10,12-13H,1,3,6-9,11H2,(H,20,22) |
| InChIKey | YHQYYPLYCGDCRE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|