C25H36N2O6 — CID 71663140
1-[(1S,6R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,10-diazabicyclo[4.3.1]decan-10-yl]-3,3-dimethylpentane-1,2-dione (PubChem CID 71663140) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is 1-[(1S,6R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,10-diazabicyclo[4.3.1]decan-10-yl]-3,3-dimethylpentane-1,2-dione.
| Compound Name | 1-[(1S,6R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,10-diazabicyclo[4.3.1]decan-10-yl]-3,3-dimethylpentane-1,2-dione |
|---|---|
| PubChem CID | 71663140 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-[(1S,6R)-3-[2-(3,4-dimethoxyphenoxy)ethyl]-2-oxo-3,10-diazabicyclo[4.3.1]decan-10-yl]-3,3-dimethylpentane-1,2-dione |
| SMILES | CCC(C)(C)C(=O)C(=O)N1[C@@H]2CCC[C@H]1C(=O)N(CCOc1ccc(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C25H36N2O6/c1-6-25(2,3)22(28)24(30)27-17-8-7-9-19(27)23(29)26(13-12-17)14-15-33-18-10-11-20(31-4)21(16-18)32-5/h10-11,16-17,19H,6-9,12-15H2,1-5H3/t17-,19+/m1/s1 |
| InChIKey | UQFAXQGZNFPZTM-MJGOQNOKSA-N |
| XLogP | 3.07 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|