C25H38N2O6 — CID 130413003
6-[[2-(3,4-dimethoxyphenoxy)ethylamino]methyl]-1-(3,3-dimethyl-2-oxohexanoyl)piperidine-2-carbaldehyde (PubChem CID 130413003) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is 6-[[2-(3,4-dimethoxyphenoxy)ethylamino]methyl]-1-(3,3-dimethyl-2-oxohexanoyl)piperidine-2-carbaldehyde.
| Compound Name | 6-[[2-(3,4-dimethoxyphenoxy)ethylamino]methyl]-1-(3,3-dimethyl-2-oxohexanoyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 130413003 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 6-[[2-(3,4-dimethoxyphenoxy)ethylamino]methyl]-1-(3,3-dimethyl-2-oxohexanoyl)piperidine-2-carbaldehyde |
| SMILES | CCCC(C)(C)C(=O)C(=O)N1C(C=O)CCCC1CNCCOc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H38N2O6/c1-6-12-25(2,3)23(29)24(30)27-18(8-7-9-19(27)17-28)16-26-13-14-33-20-10-11-21(31-4)22(15-20)32-5/h10-11,15,17-19,26H,6-9,12-14,16H2,1-5H3 |
| InChIKey | KLVBGJYUOLLLQX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|