C17H29NO3Si — CID 90054588
(Z)-N-[2-(3,4-dimethoxyphenoxy)ethyl]-4-trimethylsilylbut-2-en-1-amine (PubChem CID 90054588) has the molecular formula C17H29NO3Si and a molecular weight of 323.51 g/mol. Its IUPAC name is (Z)-N-[2-(3,4-dimethoxyphenoxy)ethyl]-4-trimethylsilylbut-2-en-1-amine.
| Compound Name | (Z)-N-[2-(3,4-dimethoxyphenoxy)ethyl]-4-trimethylsilylbut-2-en-1-amine |
|---|---|
| PubChem CID | 90054588 |
| Molecular Formula | C17H29NO3Si |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (Z)-N-[2-(3,4-dimethoxyphenoxy)ethyl]-4-trimethylsilylbut-2-en-1-amine |
| SMILES | COc1ccc(OCCNC/C=C\C[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C17H29NO3Si/c1-19-16-9-8-15(14-17(16)20-2)21-12-11-18-10-6-7-13-22(3,4)5/h6-9,14,18H,10-13H2,1-5H3/b7-6- |
| InChIKey | FDHFUVNXIYVGGC-SREVYHEPSA-N |
| XLogP | 3.57 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|