C10H17ClN2O3 — CID 3053306
2-(2,5-dimethoxyphenoxy)ethylhydrazine;hydrochloride (PubChem CID 3053306) has the molecular formula C10H17ClN2O3 and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenoxy)ethylhydrazine;hydrochloride.
| Compound Name | 2-(2,5-dimethoxyphenoxy)ethylhydrazine;hydrochloride |
|---|---|
| PubChem CID | 3053306 |
| Molecular Formula | C10H17ClN2O3 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenoxy)ethylhydrazine;hydrochloride |
| SMILES | COc1ccc(OC)c(OCCNN)c1.Cl |
| InChI | InChI=1S/C10H16N2O3.ClH/c1-13-8-3-4-9(14-2)10(7-8)15-6-5-12-11;/h3-4,7,12H,5-6,11H2,1-2H3;1H |
| InChIKey | JWQASAMXQAMJKD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|