C10H16N2O3 — CID 3053305
2-(2,4-dimethoxyphenoxy)ethylhydrazine (PubChem CID 3053305) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenoxy)ethylhydrazine.
| Compound Name | 2-(2,4-dimethoxyphenoxy)ethylhydrazine |
|---|---|
| PubChem CID | 3053305 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-(2,4-dimethoxyphenoxy)ethylhydrazine |
| SMILES | COc1ccc(OCCNN)c(OC)c1 |
| InChI | InChI=1S/C10H16N2O3/c1-13-8-3-4-9(10(7-8)14-2)15-6-5-12-11/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | SRPIPPJFWIUYMH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|