C22H25FO4 — CID 134853385
4-[(Z)-5-(3,4-dimethoxyphenyl)-4-fluoro-3,3-dimethylpent-4-enoxy]benzaldehyde (PubChem CID 134853385) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-[(Z)-5-(3,4-dimethoxyphenyl)-4-fluoro-3,3-dimethylpent-4-enoxy]benzaldehyde.
| Compound Name | 4-[(Z)-5-(3,4-dimethoxyphenyl)-4-fluoro-3,3-dimethylpent-4-enoxy]benzaldehyde |
|---|---|
| PubChem CID | 134853385 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[(Z)-5-(3,4-dimethoxyphenyl)-4-fluoro-3,3-dimethylpent-4-enoxy]benzaldehyde |
| SMILES | COc1ccc(/C=C(\F)C(C)(C)CCOc2ccc(C=O)cc2)cc1OC |
| InChI | InChI=1S/C22H25FO4/c1-22(2,11-12-27-18-8-5-16(15-24)6-9-18)21(23)14-17-7-10-19(25-3)20(13-17)26-4/h5-10,13-15H,11-12H2,1-4H3/b21-14- |
| InChIKey | AVTUODJJBCOLEW-STZFKDTASA-N |
| XLogP | 5.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|