C24H27NO6S — CID 53390924
4-[4-[(2-cyclopentyl-3-oxo-1,2-benzothiazol-6-yl)oxy]butoxy]-3-methoxybenzoic acid (PubChem CID 53390924) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is 4-[4-[(2-cyclopentyl-3-oxo-1,2-benzothiazol-6-yl)oxy]butoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[4-[(2-cyclopentyl-3-oxo-1,2-benzothiazol-6-yl)oxy]butoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 53390924 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-[4-[(2-cyclopentyl-3-oxo-1,2-benzothiazol-6-yl)oxy]butoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCCOc1ccc2c(=O)n(C3CCCC3)sc2c1 |
| InChI | InChI=1S/C24H27NO6S/c1-29-21-14-16(24(27)28)8-11-20(21)31-13-5-4-12-30-18-9-10-19-22(15-18)32-25(23(19)26)17-6-2-3-7-17/h8-11,14-15,17H,2-7,12-13H2,1H3,(H,27,28) |
| InChIKey | GZFMOWONVCCZGO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|