C34H38N2O7 — CID 142038742
(6-phenyl-1-pyridin-3-ylhexan-3-yl) (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,6-dihydro-2H-pyridine-2-carboxylate (PubChem CID 142038742) has the molecular formula C34H38N2O7 and a molecular weight of 586.69 g/mol. Its IUPAC name is (6-phenyl-1-pyridin-3-ylhexan-3-yl) (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,6-dihydro-2H-pyridine-2-carboxylate.
| Compound Name | (6-phenyl-1-pyridin-3-ylhexan-3-yl) (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,6-dihydro-2H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142038742 |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (6-phenyl-1-pyridin-3-ylhexan-3-yl) (2S)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]-3,6-dihydro-2H-pyridine-2-carboxylate |
| SMILES | COc1cc(C(=O)C(=O)N2CC=CC[C@H]2C(=O)OC(CCCc2ccccc2)CCc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C34H38N2O7/c1-40-29-21-26(22-30(41-2)32(29)42-3)31(37)33(38)36-20-8-7-16-28(36)34(39)43-27(18-17-25-14-10-19-35-23-25)15-9-13-24-11-5-4-6-12-24/h4-8,10-12,14,19,21-23,27-28H,9,13,15-18,20H2,1-3H3/t27?,28-/m0/s1 |
| InChIKey | OHXVCRSANPJDEX-CPRJBALCSA-N |
| XLogP | 5.01 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|