C20H23N3O4 — CID 18588077
1-N-(2,3-dimethoxyphenyl)-2-N-ethyl-2,3-dihydroindole-1,2-dicarboxamide (PubChem CID 18588077) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-N-(2,3-dimethoxyphenyl)-2-N-ethyl-2,3-dihydroindole-1,2-dicarboxamide.
| Compound Name | 1-N-(2,3-dimethoxyphenyl)-2-N-ethyl-2,3-dihydroindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 18588077 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-N-(2,3-dimethoxyphenyl)-2-N-ethyl-2,3-dihydroindole-1,2-dicarboxamide |
| SMILES | CCNC(=O)C1Cc2ccccc2N1C(=O)Nc1cccc(OC)c1OC |
| InChI | InChI=1S/C20H23N3O4/c1-4-21-19(24)16-12-13-8-5-6-10-15(13)23(16)20(25)22-14-9-7-11-17(26-2)18(14)27-3/h5-11,16H,4,12H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | KNGLSEXJGRMRFK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |