C18H19N3O4 — CID 41232320
(2R)-1-N-(2,4-dimethoxyphenyl)-2,3-dihydroindole-1,2-dicarboxamide (PubChem CID 41232320) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (2R)-1-N-(2,4-dimethoxyphenyl)-2,3-dihydroindole-1,2-dicarboxamide.
| Compound Name | (2R)-1-N-(2,4-dimethoxyphenyl)-2,3-dihydroindole-1,2-dicarboxamide |
|---|---|
| PubChem CID | 41232320 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-1-N-(2,4-dimethoxyphenyl)-2,3-dihydroindole-1,2-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2c3ccccc3C[C@@H]2C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O4/c1-24-12-7-8-13(16(10-12)25-2)20-18(23)21-14-6-4-3-5-11(14)9-15(21)17(19)22/h3-8,10,15H,9H2,1-2H3,(H2,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | ZHOPODREHBEVNK-OAHLLOKOSA-N |
| XLogP | 2.15 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |