C18H14N2O3 — CID 18587951
1-(1-benzofuran-2-carbonyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 18587951) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-(1-benzofuran-2-carbonyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | 1-(1-benzofuran-2-carbonyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 18587951 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(1-benzofuran-2-carbonyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | NC(=O)C1Cc2ccccc2N1C(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H14N2O3/c19-17(21)14-9-11-5-1-3-7-13(11)20(14)18(22)16-10-12-6-2-4-8-15(12)23-16/h1-8,10,14H,9H2,(H2,19,21) |
| InChIKey | BDJASIXWJVHXPJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |