C14H11NO4 — CID 43196856
1-(furan-3-carbonyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 43196856) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-(furan-3-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 43196856 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(furan-3-carbonyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N1C(=O)c1ccoc1 |
| InChI | InChI=1S/C14H11NO4/c16-13(10-5-6-19-8-10)15-11-4-2-1-3-9(11)7-12(15)14(17)18/h1-6,8,12H,7H2,(H,17,18) |
| InChIKey | KQCUJCHJXYIDJT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |