C16H12INO3 — CID 43196844
1-(2-iodobenzoyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 43196844) has the molecular formula C16H12INO3 and a molecular weight of 393.18 g/mol. Its IUPAC name is 1-(2-iodobenzoyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-(2-iodobenzoyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 43196844 |
| Molecular Formula | C16H12INO3 |
| Molecular Weight | 393.18 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 1-(2-iodobenzoyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2N1C(=O)c1ccccc1I |
| InChI | InChI=1S/C16H12INO3/c17-12-7-3-2-6-11(12)15(19)18-13-8-4-1-5-10(13)9-14(18)16(20)21/h1-8,14H,9H2,(H,20,21) |
| InChIKey | SSSOSKXFDZRMFG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|