C13H13N3O4 — CID 95157812
(2S)-1-[(1S,2R)-2-nitrocyclopropanecarbonyl]-2,3-dihydroindole-2-carboxamide (PubChem CID 95157812) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is (2S)-1-[(1S,2R)-2-nitrocyclopropanecarbonyl]-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-[(1S,2R)-2-nitrocyclopropanecarbonyl]-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 95157812 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-1-[(1S,2R)-2-nitrocyclopropanecarbonyl]-2,3-dihydroindole-2-carboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2N1C(=O)[C@H]1C[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N3O4/c14-12(17)11-5-7-3-1-2-4-9(7)15(11)13(18)8-6-10(8)16(19)20/h1-4,8,10-11H,5-6H2,(H2,14,17)/t8-,10+,11-/m0/s1 |
| InChIKey | FQULZGNYBVEVLG-GDPRMGEGSA-N |
| XLogP | 0.09 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|