C20H21N3O3 — CID 47087166
(2S)-1-(3-benzamidobutanoyl)-2,3-dihydroindole-2-carboxamide (PubChem CID 47087166) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (2S)-1-(3-benzamidobutanoyl)-2,3-dihydroindole-2-carboxamide.
| Compound Name | (2S)-1-(3-benzamidobutanoyl)-2,3-dihydroindole-2-carboxamide |
|---|---|
| PubChem CID | 47087166 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2S)-1-(3-benzamidobutanoyl)-2,3-dihydroindole-2-carboxamide |
| SMILES | CC(CC(=O)N1c2ccccc2C[C@H]1C(N)=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3/c1-13(22-20(26)14-7-3-2-4-8-14)11-18(24)23-16-10-6-5-9-15(16)12-17(23)19(21)25/h2-10,13,17H,11-12H2,1H3,(H2,21,25)(H,22,26)/t13?,17-/m0/s1 |
| InChIKey | BTSXYUWBHGTJQT-RUINGEJQSA-N |
| XLogP | 1.64 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |