About [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate
[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate (PubChem CID 2342367) has the molecular formula C27H26N2O4
and a molecular weight of 442.52 g/mol. Its IUPAC name is [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate |
| PubChem CID | 2342367 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c1-19-16-22-14-8-9-15-24(22)29(19)25(30)18-33-27(32)23(17-20-10-4-2-5-11-20)28-26(31)21-12-6-3-7-13-21/h2-15,19,23H,16-18H2,1H3,(H,28,31)/t19-,23-/m1/s1 |
| InChIKey | MJMCYCRURMKAOI-AUSIDOKSSA-N |
| XLogP | 3.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate?
The IUPAC name of [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate (CID 2342367) is [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate.
What is the SMILES notation for [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate?
The canonical SMILES for [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate is C[C@@H]1Cc2ccccc2N1C(=O)COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1.
What is the InChIKey of [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate?
The InChIKey is MJMCYCRURMKAOI-AUSIDOKSSA-N. The full InChI is InChI=1S/C27H26N2O4/c1-19-16-22-14-8-9-15-24(22)29(19)25(30)18-33-27(32)23(17-20-10-4-2-5-11-20)28-26(31)21-12-6-3-7-13-21/h2-15,19,23H,16-18H2,1H3,(H,28,31)/t19-,23-/m1/s1.
What are the key properties of [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate?
[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate has a molecular weight of 442.52 g/mol, XLogP of 3.55, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (2R)-2-benzamido-3-phenylpropanoate is sourced from PubChem (CID 2342367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).