C18H26N4O3 — CID 86981010
4-(3-benzamidobutanoyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 86981010) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(3-benzamidobutanoyl)-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-benzamidobutanoyl)-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 86981010 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-(3-benzamidobutanoyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CC(CC(=O)N1CCN(C(=O)N(C)C)CC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N4O3/c1-14(19-17(24)15-7-5-4-6-8-15)13-16(23)21-9-11-22(12-10-21)18(25)20(2)3/h4-8,14H,9-13H2,1-3H3,(H,19,24) |
| InChIKey | LQKGHWPETZGAMU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |