C18H26N2O4S — CID 124875313
N-[(2S)-4-[(4S)-4-methylsulfonylazepan-1-yl]-4-oxobutan-2-yl]benzamide (PubChem CID 124875313) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-[(2S)-4-[(4S)-4-methylsulfonylazepan-1-yl]-4-oxobutan-2-yl]benzamide.
| Compound Name | N-[(2S)-4-[(4S)-4-methylsulfonylazepan-1-yl]-4-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 124875313 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-[(2S)-4-[(4S)-4-methylsulfonylazepan-1-yl]-4-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](CC(=O)N1CCC[C@H](S(C)(=O)=O)CC1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-14(19-18(22)15-7-4-3-5-8-15)13-17(21)20-11-6-9-16(10-12-20)25(2,23)24/h3-5,7-8,14,16H,6,9-13H2,1-2H3,(H,19,22)/t14-,16-/m0/s1 |
| InChIKey | ANMIFRBHNGPFOW-HOCLYGCPSA-N |
| XLogP | 1.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |