C23H35N3O4 — CID 47796330
tert-butyl N-[[1-(3-benzamidobutanoyl)piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 47796330) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-benzamidobutanoyl)piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-(3-benzamidobutanoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 47796330 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | tert-butyl N-[[1-(3-benzamidobutanoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CC(CC(=O)N1CCCC(CN(C)C(=O)OC(C)(C)C)C1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H35N3O4/c1-17(24-21(28)19-11-7-6-8-12-19)14-20(27)26-13-9-10-18(16-26)15-25(5)22(29)30-23(2,3)4/h6-8,11-12,17-18H,9-10,13-16H2,1-5H3,(H,24,28) |
| InChIKey | HPVLWEJQWAMADF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |