C26H32N2O4 — CID 60587387
tert-butyl N-[[1-(2-benzoylbenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 60587387) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-benzoylbenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-(2-benzoylbenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 60587387 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | tert-butyl N-[[1-(2-benzoylbenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CN(CC1CCCN(C(=O)c2ccccc2C(=O)c2ccccc2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N2O4/c1-26(2,3)32-25(31)27(4)17-19-11-10-16-28(18-19)24(30)22-15-9-8-14-21(22)23(29)20-12-6-5-7-13-20/h5-9,12-15,19H,10-11,16-18H2,1-4H3 |
| InChIKey | HPNRKNJCWHMSSV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |