C19H30N2O4 — CID 47796215
tert-butyl N-[[1-(5-ethylfuran-2-carbonyl)piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 47796215) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-ethylfuran-2-carbonyl)piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-(5-ethylfuran-2-carbonyl)piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 47796215 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl N-[[1-(5-ethylfuran-2-carbonyl)piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CCc1ccc(C(=O)N2CCCC(CN(C)C(=O)OC(C)(C)C)C2)o1 |
| InChI | InChI=1S/C19H30N2O4/c1-6-15-9-10-16(24-15)17(22)21-11-7-8-14(13-21)12-20(5)18(23)25-19(2,3)4/h9-10,14H,6-8,11-13H2,1-5H3 |
| InChIKey | STQCARLPQUXQTG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |