C20H30N2O4 — CID 52512093
tert-butyl N-[[(3R)-1-(2-methoxybenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 52512093) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(2-methoxybenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(2-methoxybenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 52512093 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(2-methoxybenzoyl)piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | COc1ccccc1C(=O)N1CCC[C@@H](CN(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30N2O4/c1-20(2,3)26-19(24)21(4)13-15-9-8-12-22(14-15)18(23)16-10-6-7-11-17(16)25-5/h6-7,10-11,15H,8-9,12-14H2,1-5H3/t15-/m0/s1 |
| InChIKey | HSJLWDCYDFXMKG-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |