C23H34N2O4 — CID 72686727
tert-butyl N-[[1-[3-(2-methoxyphenyl)but-2-enoyl]piperidin-4-yl]methyl]-N-methylcarbamate (PubChem CID 72686727) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(2-methoxyphenyl)but-2-enoyl]piperidin-4-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-[3-(2-methoxyphenyl)but-2-enoyl]piperidin-4-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 72686727 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | tert-butyl N-[[1-[3-(2-methoxyphenyl)but-2-enoyl]piperidin-4-yl]methyl]-N-methylcarbamate |
| SMILES | COc1ccccc1C(C)=CC(=O)N1CCC(CN(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H34N2O4/c1-17(19-9-7-8-10-20(19)28-6)15-21(26)25-13-11-18(12-14-25)16-24(5)22(27)29-23(2,3)4/h7-10,15,18H,11-14,16H2,1-6H3 |
| InChIKey | SWWRCDQWIRABMV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|