C14H15NO4 — CID 102220091
benzyl 2-(2-oxoethyl)-2,3-dihydro-1,4-oxazine-4-carboxylate (PubChem CID 102220091) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is benzyl 2-(2-oxoethyl)-2,3-dihydro-1,4-oxazine-4-carboxylate.
| Compound Name | benzyl 2-(2-oxoethyl)-2,3-dihydro-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 102220091 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | benzyl 2-(2-oxoethyl)-2,3-dihydro-1,4-oxazine-4-carboxylate |
| SMILES | O=CCC1CN(C(=O)OCc2ccccc2)C=CO1 |
| InChI | InChI=1S/C14H15NO4/c16-8-6-13-10-15(7-9-18-13)14(17)19-11-12-4-2-1-3-5-12/h1-5,7-9,13H,6,10-11H2 |
| InChIKey | JRIBUHZJRYZKHA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|