C15H17NO4 — CID 102220098
benzyl 2-(1-oxopropan-2-yl)-2,3-dihydro-1,4-oxazine-4-carboxylate (PubChem CID 102220098) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is benzyl 2-(1-oxopropan-2-yl)-2,3-dihydro-1,4-oxazine-4-carboxylate.
| Compound Name | benzyl 2-(1-oxopropan-2-yl)-2,3-dihydro-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 102220098 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | benzyl 2-(1-oxopropan-2-yl)-2,3-dihydro-1,4-oxazine-4-carboxylate |
| SMILES | CC(C=O)C1CN(C(=O)OCc2ccccc2)C=CO1 |
| InChI | InChI=1S/C15H17NO4/c1-12(10-17)14-9-16(7-8-19-14)15(18)20-11-13-5-3-2-4-6-13/h2-8,10,12,14H,9,11H2,1H3 |
| InChIKey | ZKCDKEXXQQBAFK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|