C24H27NO9 — CID 101195349
benzyl (2S,3S,4R)-3,4-diacetyloxy-2-(4-ethoxycarbonyl-5-methylfuran-2-yl)pyrrolidine-1-carboxylate (PubChem CID 101195349) has the molecular formula C24H27NO9 and a molecular weight of 473.48 g/mol. Its IUPAC name is benzyl (2S,3S,4R)-3,4-diacetyloxy-2-(4-ethoxycarbonyl-5-methylfuran-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3S,4R)-3,4-diacetyloxy-2-(4-ethoxycarbonyl-5-methylfuran-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101195349 |
| Molecular Formula | C24H27NO9 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | benzyl (2S,3S,4R)-3,4-diacetyloxy-2-(4-ethoxycarbonyl-5-methylfuran-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2[C@H](OC(C)=O)[C@H](OC(C)=O)CN2C(=O)OCc2ccccc2)oc1C |
| InChI | InChI=1S/C24H27NO9/c1-5-30-23(28)18-11-19(32-14(18)2)21-22(34-16(4)27)20(33-15(3)26)12-25(21)24(29)31-13-17-9-7-6-8-10-17/h6-11,20-22H,5,12-13H2,1-4H3/t20-,21-,22-/m1/s1 |
| InChIKey | BKFDJSKCPXDWNA-YPAWHYETSA-N |
| XLogP | 3.32 |
| TPSA | 121.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|