C37H58O9Si — CID 11061393
ethyl (3S)-3-[(2S,3S,4S,5R,6R)-5-methoxy-6-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2,4-dimethyl-1-trimethylsilyloxyheptan-3-yl]oxy-3-(4-methoxyphenyl)propanoate (PubChem CID 11061393) has the molecular formula C37H58O9Si and a molecular weight of 674.95 g/mol. Its IUPAC name is ethyl (3S)-3-[(2S,3S,4S,5R,6R)-5-methoxy-6-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2,4-dimethyl-1-trimethylsilyloxyheptan-3-yl]oxy-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-[(2S,3S,4S,5R,6R)-5-methoxy-6-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2,4-dimethyl-1-trimethylsilyloxyheptan-3-yl]oxy-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11061393 |
| Molecular Formula | C37H58O9Si |
| Molecular Weight | 674.95 g/mol |
| Exact Mass | 674.39 |
| IUPAC Name | ethyl (3S)-3-[(2S,3S,4S,5R,6R)-5-methoxy-6-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2,4-dimethyl-1-trimethylsilyloxyheptan-3-yl]oxy-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C[C@H](O[C@H]([C@@H](C)[C@@H](OC)[C@@H](C)[C@@H]1O[C@H](c2ccc(OC)cc2)OC[C@H]1C)[C@@H](C)CO[Si](C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C37H58O9Si/c1-12-42-33(38)21-32(28-13-17-30(39-6)18-14-28)45-34(25(3)23-44-47(9,10)11)26(4)36(41-8)27(5)35-24(2)22-43-37(46-35)29-15-19-31(40-7)20-16-29/h13-20,24-27,32,34-37H,12,21-23H2,1-11H3/t24-,25+,26-,27+,32+,34+,35-,36-,37-/m1/s1 |
| InChIKey | ZBTMALTUFVYJGP-PDUNQSHYSA-N |
| XLogP | 7.61 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.95 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|