About 4-methoxybenzene-1,3-diol;2-methyloxirane
4-methoxybenzene-1,3-diol;2-methyloxirane (PubChem CID 131711455) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-methoxybenzene-1,3-diol;2-methyloxirane.
Molecular Properties
| Compound Name | 4-methoxybenzene-1,3-diol;2-methyloxirane |
| PubChem CID | 131711455 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-methoxybenzene-1,3-diol;2-methyloxirane |
| SMILES | CC1CO1.COc1ccc(O)cc1O |
| InChI | InChI=1S/C7H8O3.C3H6O/c1-10-7-3-2-5(8)4-6(7)9;1-3-2-4-3/h2-4,8-9H,1H3;3H,2H2,1H3 |
| InChIKey | RWLTZMDZGCQXLG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybenzene-1,3-diol;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzene-1,3-diol;2-methyloxirane?
The IUPAC name of 4-methoxybenzene-1,3-diol;2-methyloxirane (CID 131711455) is 4-methoxybenzene-1,3-diol;2-methyloxirane.
What is the SMILES notation for 4-methoxybenzene-1,3-diol;2-methyloxirane?
The canonical SMILES for 4-methoxybenzene-1,3-diol;2-methyloxirane is CC1CO1.COc1ccc(O)cc1O.
What is the InChIKey of 4-methoxybenzene-1,3-diol;2-methyloxirane?
The InChIKey is RWLTZMDZGCQXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3.C3H6O/c1-10-7-3-2-5(8)4-6(7)9;1-3-2-4-3/h2-4,8-9H,1H3;3H,2H2,1H3.
What are the key properties of 4-methoxybenzene-1,3-diol;2-methyloxirane?
4-methoxybenzene-1,3-diol;2-methyloxirane has a molecular weight of 198.22 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzene-1,3-diol;2-methyloxirane is sourced from PubChem (CID 131711455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).