C10H14O4 — CID 131711455
4-methoxybenzene-1,3-diol;2-methyloxirane (PubChem CID 131711455) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-methoxybenzene-1,3-diol;2-methyloxirane.
| Compound Name | 4-methoxybenzene-1,3-diol;2-methyloxirane |
|---|---|
| PubChem CID | 131711455 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-methoxybenzene-1,3-diol;2-methyloxirane |
| SMILES | CC1CO1.COc1ccc(O)cc1O |
| InChI | InChI=1S/C7H8O3.C3H6O/c1-10-7-3-2-5(8)4-6(7)9;1-3-2-4-3/h2-4,8-9H,1H3;3H,2H2,1H3 |
| InChIKey | RWLTZMDZGCQXLG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|