C21H26O6 — CID 162969643
5-[(2S,4S,5S)-4-(3,4-dimethoxyphenyl)-5-methoxyoxan-2-yl]-2-methoxyphenol (PubChem CID 162969643) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 5-[(2S,4S,5S)-4-(3,4-dimethoxyphenyl)-5-methoxyoxan-2-yl]-2-methoxyphenol.
| Compound Name | 5-[(2S,4S,5S)-4-(3,4-dimethoxyphenyl)-5-methoxyoxan-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 162969643 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 5-[(2S,4S,5S)-4-(3,4-dimethoxyphenyl)-5-methoxyoxan-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc([C@@H]2C[C@@H](c3ccc(OC)c(OC)c3)[C@H](OC)CO2)cc1O |
| InChI | InChI=1S/C21H26O6/c1-23-17-7-6-14(9-16(17)22)19-11-15(21(26-4)12-27-19)13-5-8-18(24-2)20(10-13)25-3/h5-10,15,19,21-22H,11-12H2,1-4H3/t15-,19-,21+/m0/s1 |
| InChIKey | WTCGOQUMVRSMDU-PAXLWEDBSA-N |
| XLogP | 3.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |