C16H13BrN2O — CID 139189475
(2Z,5R)-2-[1-(4-bromophenyl)ethylidene]-5-ethenyloxolane-3,3-dicarbonitrile (PubChem CID 139189475) has the molecular formula C16H13BrN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is (2Z,5R)-2-[1-(4-bromophenyl)ethylidene]-5-ethenyloxolane-3,3-dicarbonitrile.
| Compound Name | (2Z,5R)-2-[1-(4-bromophenyl)ethylidene]-5-ethenyloxolane-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 139189475 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (2Z,5R)-2-[1-(4-bromophenyl)ethylidene]-5-ethenyloxolane-3,3-dicarbonitrile |
| SMILES | C=C[C@H]1CC(C#N)(C#N)/C(=C(\C)c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C16H13BrN2O/c1-3-14-8-16(9-18,10-19)15(20-14)11(2)12-4-6-13(17)7-5-12/h3-7,14H,1,8H2,2H3/b15-11-/t14-/m0/s1 |
| InChIKey | PKSBFBVZYNJZOR-XFNCEPBJSA-N |
| XLogP | 4.19 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|