C32H16Br4N4 — CID 139204036
(E)-2,3-bis(4-bromophenyl)but-2-enedinitrile (PubChem CID 139204036) has the molecular formula C32H16Br4N4 and a molecular weight of 776.12 g/mol. Its IUPAC name is (E)-2,3-bis(4-bromophenyl)but-2-enedinitrile.
| Compound Name | (E)-2,3-bis(4-bromophenyl)but-2-enedinitrile |
|---|---|
| PubChem CID | 139204036 |
| Molecular Formula | C32H16Br4N4 |
| Molecular Weight | 776.12 g/mol |
| Exact Mass | 771.81 |
| IUPAC Name | (E)-2,3-bis(4-bromophenyl)but-2-enedinitrile |
| SMILES | N#C/C(=C(/C#N)c1ccc(Br)cc1)c1ccc(Br)cc1.N#C/C(=C(/C#N)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/2C16H8Br2N2/c2*17-13-5-1-11(2-6-13)15(9-19)16(10-20)12-3-7-14(18)8-4-12/h2*1-8H/b2*16-15+ |
| InChIKey | WQLPZKMMSTYKMG-STPNLYBRSA-N |
| XLogP | 10.34 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.12 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|