C16H9Br3 — CID 139454142
1-bromo-4-(1,1-dibromo-4-phenylbut-1-en-3-yn-2-yl)benzene (PubChem CID 139454142) has the molecular formula C16H9Br3 and a molecular weight of 440.96 g/mol. Its IUPAC name is 1-bromo-4-(1,1-dibromo-4-phenylbut-1-en-3-yn-2-yl)benzene.
| Compound Name | 1-bromo-4-(1,1-dibromo-4-phenylbut-1-en-3-yn-2-yl)benzene |
|---|---|
| PubChem CID | 139454142 |
| Molecular Formula | C16H9Br3 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 437.83 |
| IUPAC Name | 1-bromo-4-(1,1-dibromo-4-phenylbut-1-en-3-yn-2-yl)benzene |
| SMILES | BrC(Br)=C(C#Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H9Br3/c17-14-9-7-13(8-10-14)15(16(18)19)11-6-12-4-2-1-3-5-12/h1-5,7-10H |
| InChIKey | XJFOXIKDOYYFPV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|