C23H17BrO — CID 71723905
3-(4-bromophenyl)-1,5-diphenylpent-4-yn-1-one (PubChem CID 71723905) has the molecular formula C23H17BrO and a molecular weight of 389.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,5-diphenylpent-4-yn-1-one.
| Compound Name | 3-(4-bromophenyl)-1,5-diphenylpent-4-yn-1-one |
|---|---|
| PubChem CID | 71723905 |
| Molecular Formula | C23H17BrO |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 3-(4-bromophenyl)-1,5-diphenylpent-4-yn-1-one |
| SMILES | O=C(CC(C#Cc1ccccc1)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H17BrO/c24-22-15-13-19(14-16-22)21(12-11-18-7-3-1-4-8-18)17-23(25)20-9-5-2-6-10-20/h1-10,13-16,21H,17H2 |
| InChIKey | LFCFCJFRHDGCKL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|