C18H12BrF3O — CID 162539698
(4R)-4-(3-bromophenyl)-1,1,1-trifluoro-6-phenylhex-5-yn-2-one (PubChem CID 162539698) has the molecular formula C18H12BrF3O and a molecular weight of 381.19 g/mol. Its IUPAC name is (4R)-4-(3-bromophenyl)-1,1,1-trifluoro-6-phenylhex-5-yn-2-one.
| Compound Name | (4R)-4-(3-bromophenyl)-1,1,1-trifluoro-6-phenylhex-5-yn-2-one |
|---|---|
| PubChem CID | 162539698 |
| Molecular Formula | C18H12BrF3O |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (4R)-4-(3-bromophenyl)-1,1,1-trifluoro-6-phenylhex-5-yn-2-one |
| SMILES | O=C(C[C@@H](C#Cc1ccccc1)c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C18H12BrF3O/c19-16-8-4-7-14(11-16)15(12-17(23)18(20,21)22)10-9-13-5-2-1-3-6-13/h1-8,11,15H,12H2/t15-/m1/s1 |
| InChIKey | NHRIVPZLJNTLEP-OAHLLOKOSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|