C14H9F3O — CID 122379739
1,1,1-trifluoro-4-phenylocta-5,7-diyn-2-one (PubChem CID 122379739) has the molecular formula C14H9F3O and a molecular weight of 250.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-phenylocta-5,7-diyn-2-one.
| Compound Name | 1,1,1-trifluoro-4-phenylocta-5,7-diyn-2-one |
|---|---|
| PubChem CID | 122379739 |
| Molecular Formula | C14H9F3O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1,1,1-trifluoro-4-phenylocta-5,7-diyn-2-one |
| SMILES | C#CC#CC(CC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H9F3O/c1-2-3-7-12(10-13(18)14(15,16)17)11-8-5-4-6-9-11/h1,4-6,8-9,12H,10H2 |
| InChIKey | ZTFCZLDGTFBMHV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|