C10H7F5O — CID 125477473
(Z,1S)-2,3,4,4,4-pentafluoro-1-phenylbut-2-en-1-ol (PubChem CID 125477473) has the molecular formula C10H7F5O and a molecular weight of 238.16 g/mol. Its IUPAC name is (Z,1S)-2,3,4,4,4-pentafluoro-1-phenylbut-2-en-1-ol.
| Compound Name | (Z,1S)-2,3,4,4,4-pentafluoro-1-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 125477473 |
| Molecular Formula | C10H7F5O |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (Z,1S)-2,3,4,4,4-pentafluoro-1-phenylbut-2-en-1-ol |
| SMILES | O[C@H](/C(F)=C(/F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H7F5O/c11-7(9(12)10(13,14)15)8(16)6-4-2-1-3-5-6/h1-5,8,16H/b9-7-/t8-/m0/s1 |
| InChIKey | QSCHFDBOEWCNOP-FZGDARCMSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |