C13H16BrN3 — CID 100986676
2-(4-bromophenyl)-3,3-bis(dimethylamino)prop-2-enenitrile (PubChem CID 100986676) has the molecular formula C13H16BrN3 and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3,3-bis(dimethylamino)prop-2-enenitrile.
| Compound Name | 2-(4-bromophenyl)-3,3-bis(dimethylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 100986676 |
| Molecular Formula | C13H16BrN3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-(4-bromophenyl)-3,3-bis(dimethylamino)prop-2-enenitrile |
| SMILES | CN(C)C(=C(C#N)c1ccc(Br)cc1)N(C)C |
| InChI | InChI=1S/C13H16BrN3/c1-16(2)13(17(3)4)12(9-15)10-5-7-11(14)8-6-10/h5-8H,1-4H3 |
| InChIKey | DVGOQDKQSIEFSX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|