C9H10BrNTe — CID 86022368
4-bromo-N,N-dimethylbenzenecarbotelluroamide (PubChem CID 86022368) has the molecular formula C9H10BrNTe and a molecular weight of 339.69 g/mol. Its IUPAC name is 4-bromo-N,N-dimethylbenzenecarbotelluroamide.
| Compound Name | 4-bromo-N,N-dimethylbenzenecarbotelluroamide |
|---|---|
| PubChem CID | 86022368 |
| Molecular Formula | C9H10BrNTe |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 4-bromo-N,N-dimethylbenzenecarbotelluroamide |
| SMILES | CN(C)C(=[Te])c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H10BrNTe/c1-11(2)9(12)7-3-5-8(10)6-4-7/h3-6H,1-2H3 |
| InChIKey | GYFMOUSBWLJOHI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|