C24H26Br2Si2 — CID 122401874
[(E)-3,4-bis(4-bromophenyl)-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 122401874) has the molecular formula C24H26Br2Si2 and a molecular weight of 530.45 g/mol. Its IUPAC name is [(E)-3,4-bis(4-bromophenyl)-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(E)-3,4-bis(4-bromophenyl)-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 122401874 |
| Molecular Formula | C24H26Br2Si2 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 527.99 |
| IUPAC Name | [(E)-3,4-bis(4-bromophenyl)-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C(=C(/C#C[Si](C)(C)C)c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H26Br2Si2/c1-27(2,3)17-15-23(19-7-11-21(25)12-8-19)24(16-18-28(4,5)6)20-9-13-22(26)14-10-20/h7-14H,1-6H3/b24-23+ |
| InChIKey | AETIKQPAXNYYRW-WCWDXBQESA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|