C11H10BrNO2 — CID 82134116
2-[2-(4-bromophenyl)-1,3-dioxolan-4-yl]acetonitrile (PubChem CID 82134116) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-1,3-dioxolan-4-yl]acetonitrile.
| Compound Name | 2-[2-(4-bromophenyl)-1,3-dioxolan-4-yl]acetonitrile |
|---|---|
| PubChem CID | 82134116 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-[2-(4-bromophenyl)-1,3-dioxolan-4-yl]acetonitrile |
| SMILES | N#CCC1COC(c2ccc(Br)cc2)O1 |
| InChI | InChI=1S/C11H10BrNO2/c12-9-3-1-8(2-4-9)11-14-7-10(15-11)5-6-13/h1-4,10-11H,5,7H2 |
| InChIKey | ANJFKXZPIMXCDY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |