C12H13BrO4 — CID 139205509
(2R,4aS,7R,7aS)-2-(4-bromophenyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol (PubChem CID 139205509) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is (2R,4aS,7R,7aS)-2-(4-bromophenyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (2R,4aS,7R,7aS)-2-(4-bromophenyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 139205509 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (2R,4aS,7R,7aS)-2-(4-bromophenyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
| SMILES | O[C@@H]1CO[C@H]2CO[C@@H](c3ccc(Br)cc3)O[C@@H]12 |
| InChI | InChI=1S/C12H13BrO4/c13-8-3-1-7(2-4-8)12-16-6-10-11(17-12)9(14)5-15-10/h1-4,9-12,14H,5-6H2/t9-,10+,11+,12-/m1/s1 |
| InChIKey | RZBPIOIVHCRRGN-NOOOWODRSA-N |
| XLogP | 1.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |